CAS 3544-47-6 is the registry number for 2-Chloro-5-methanesulfonylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-5-methylsulfonylbenzenesulfonamide (CAS 3544-47-6) is a chemical compound with the molecular formula C7H8ClNO4S2 and a molecular weight of 269.7 g/mol. IUPAC name: 2-chloro-5-methylsulfonylbenzenesulfonamide. InChIKey: BBCWUIJFWBSIJP-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO4S2 |
|---|---|
| Molecular weight | 269.7 g/mol |
| IUPAC name | 2-chloro-5-methylsulfonylbenzenesulfonamide |
| InChIKey | BBCWUIJFWBSIJP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)