CAS 2472431-71-1 appears in our catalog under these names: rel-(1r,4r)-4-Hydroxy-4-(trifluoromethyl)cyclohexanecarboxylic acid, 97%, trans-4-Hydroxy-4-(trifluoromethyl)cyclohexane-1-carboxylic acid, 95%, 95%, trans-4-Hydroxy-4-(trifluoromethyl)cyclohexane-1-carboxylic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
4-hydroxy-4-(trifluoromethyl)cyclohexane-1-carboxylic acid (CAS 2472431-71-1) is a chemical compound with the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. IUPAC name: 4-hydroxy-4-(trifluoromethyl)cyclohexane-1-carboxylic acid. InChIKey: FIUBKGKIMNZJSO-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O3 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 4-hydroxy-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| InChIKey | FIUBKGKIMNZJSO-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)(C(F)(F)F)O |
Computed by PubChem (NCBI)