CAS 480438-81-1 appears in our catalog under these names: 3,3,3-Trifluoro-(2-tetrahydrofuranylmethyl)propionic acid, 95%, 3,3,3-Trifluoro-2-((tetrahydrofuran-2-yl)methyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
3,3,3-trifluoro-2-(oxolan-2-ylmethyl)propanoic acid (CAS 480438-81-1) is a chemical compound with the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. IUPAC name: 3,3,3-trifluoro-2-(oxolan-2-ylmethyl)propanoic acid. InChIKey: FQJZEDBSHBNUMD-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O3 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-(oxolan-2-ylmethyl)propanoic acid |
| InChIKey | FQJZEDBSHBNUMD-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CC(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)