CAS 24725-60-8 is the registry number for 4,5-Dichloro-2-(4-nitrophenyl)-2,3-dihydropyridazin-3-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4,5-dichloro-2-(4-nitrophenyl)pyridazin-3-one (CAS 24725-60-8) is a chemical compound with the molecular formula C10H5Cl2N3O3 and a molecular weight of 286.07 g/mol. IUPAC name: 4,5-dichloro-2-(4-nitrophenyl)pyridazin-3-one. InChIKey: QARILIFILZKMIE-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2N3O3 |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 4,5-dichloro-2-(4-nitrophenyl)pyridazin-3-one |
| InChIKey | QARILIFILZKMIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C(=C(C=N2)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)