CAS 76661-24-0 appears in our catalog under these names: 2,5–Dichloro–4–(3–nitrophenoxy)pyrimidine, 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine 97%, 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine, 97%, 97%, 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
2,5-dichloro-4-(3-nitrophenoxy)pyrimidine (CAS 76661-24-0) is a chemical compound with the molecular formula C10H5Cl2N3O3 and a molecular weight of 286.07 g/mol. IUPAC name: 2,5-dichloro-4-(3-nitrophenoxy)pyrimidine. InChIKey: SEGZIOXGXFJLHD-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2N3O3 |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 2,5-dichloro-4-(3-nitrophenoxy)pyrimidine |
| InChIKey | SEGZIOXGXFJLHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=NC(=NC=C2Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)