CAS 2474774-16-6 is the registry number for Siponimod Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-[(4-acetyl-2-ethylphenyl)methyl]azetidine-3-carboxylate (CAS 2474774-16-6) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: methyl 1-[(4-acetyl-2-ethylphenyl)methyl]azetidine-3-carboxylate. InChIKey: NBZBZASQAOASBB-UHFFFAOYSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | methyl 1-[(4-acetyl-2-ethylphenyl)methyl]azetidine-3-carboxylate |
| InChIKey | NBZBZASQAOASBB-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)C(=O)C)CN2CC(C2)C(=O)OC |
Computed by PubChem (NCBI)