Products 247564-69-8
CAS 247564-69-8 is the registry number for 4,5,7-Trifluoro-1H-indole-2-carboxylic acid, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4,5,7-trifluoro-1H-indole-2-carboxylic acid (CAS 247564-69-8) is a chemical compound with the molecular formula C9H4F3NO2 and a molecular weight of 215.13 g/mol. IUPAC name: 4,5,7-trifluoro-1H-indole-2-carboxylic acid. InChIKey: VJVDGXIPCUHAHO-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO2 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 4,5,7-trifluoro-1H-indole-2-carboxylic acid |
| InChIKey | VJVDGXIPCUHAHO-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C=C(N2)C(=O)O)C(=C1F)F)F |
Computed by PubChem (NCBI)