CAS 247570-04-3 appears in our catalog under these names: (1-Benzothien-2-ylmethyl)amine hydrochloride, 95%, (1-Benzothien-2-ylmethyl)amine Hydrochloride. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 500mg, 750mg, 5g.
1-benzothiophen-2-ylmethanamine;hydrochloride (CAS 247570-04-3) is a chemical compound with the molecular formula C9H10ClNS and a molecular weight of 199.70 g/mol. IUPAC name: 1-benzothiophen-2-ylmethanamine;hydrochloride. InChIKey: DGXQRMAGSLCKHT-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNS |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | 1-benzothiophen-2-ylmethanamine;hydrochloride |
| InChIKey | DGXQRMAGSLCKHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)CN.Cl |
Computed by PubChem (NCBI)