CAS 55810-74-7 appears in our catalog under these names: 1-Benzothiophen-3-ylmethylamine hydrochloride, 1-Benzothiophen-3-ylmethylamine hydrochloride, 95% , Benzo[b]thiophen-3-ylmethanamine hydrochloride 95%, Benzo[b]thiophen-3-ylmethanamine hydrochloride, 99%+, 99%+, Benzo[b]thiophen-3-ylmethanamine hydrochloride, 98%. Offered by: Biosynth, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 1g, 5g, 250mg, 100mg.
1-benzothiophen-3-ylmethanamine;hydrochloride (CAS 55810-74-7) is a chemical compound with the molecular formula C9H10ClNS and a molecular weight of 199.70 g/mol. IUPAC name: 1-benzothiophen-3-ylmethanamine;hydrochloride. InChIKey: MIAPJPCDRSPNPW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNS |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | 1-benzothiophen-3-ylmethanamine;hydrochloride |
| InChIKey | MIAPJPCDRSPNPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)CN.Cl |
Computed by PubChem (NCBI)