Products 24786-51-4
CAS 24786-51-4 appears in our catalog under these names: 5-Bromo-1,3-dimethyl-6-nitro-1,3-benzodiazol-2-one, 97%, 5-Bromo-1,3-dimethyl-6-nitro-1,3-dihydro-2H-benzo(d)imidazol-2-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
5-bromo-1,3-dimethyl-6-nitrobenzimidazol-2-one (CAS 24786-51-4) is a chemical compound with the molecular formula C9H8BrN3O3 and a molecular weight of 286.08 g/mol. IUPAC name: 5-bromo-1,3-dimethyl-6-nitrobenzimidazol-2-one. InChIKey: KSBADKLBNVEZNI-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O3 |
|---|---|
| Molecular weight | 286.08 g/mol |
| IUPAC name | 5-bromo-1,3-dimethyl-6-nitrobenzimidazol-2-one |
| InChIKey | KSBADKLBNVEZNI-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=C(C=C2N(C1=O)C)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)