Products 914636-18-3
CAS 914636-18-3 is the registry number for Acetone 4-bromo-2-nitrophenylhydrazone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(1E)-1-[(4-bromo-2-nitrophenyl)hydrazinylidene]propan-2-one (CAS 914636-18-3) is a chemical compound with the molecular formula C9H8BrN3O3 and a molecular weight of 286.08 g/mol. IUPAC name: (1E)-1-[(4-bromo-2-nitrophenyl)hydrazinylidene]propan-2-one. InChIKey: UHWFZMCTMUTLBY-VZUCSPMQSA-N.
| Molecular formula | C9H8BrN3O3 |
|---|---|
| Molecular weight | 286.08 g/mol |
| IUPAC name | (1E)-1-[(4-bromo-2-nitrophenyl)hydrazinylidene]propan-2-one |
| InChIKey | UHWFZMCTMUTLBY-VZUCSPMQSA-N |
| SMILES | CC(=O)/C=N/NC1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)