Products 2479-49-4
CAS 2479-49-4 appears in our catalog under these names: Benzophenonetetracarboxylic acid/ 97.39% (existing batch purity), Benzophenonetetracarboxylic acid (Benzophenone–3,3',4,4'–tetracarbonic acid), Benzophenonetetracarboxylic acid 98%, 4,4'-Carbonyldiphthalic acid, 98%, 98%, Benzophenonetetracarboxylic acid, 99.55%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml water), 1mg, 250mg.
4-(3,4-dicarboxybenzoyl)phthalic acid (CAS 2479-49-4) is a chemical compound with the molecular formula C17H10O9 and a molecular weight of 358.3 g/mol. IUPAC name: 4-(3,4-dicarboxybenzoyl)phthalic acid. InChIKey: UITKHKNFVCYWNG-UHFFFAOYSA-N.
| Molecular formula | C17H10O9 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 4-(3,4-dicarboxybenzoyl)phthalic acid |
| InChIKey | UITKHKNFVCYWNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C2=CC(=C(C=C2)C(=O)O)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4,4'-Carbonyldiphthalic acid, BENZOPHENONETETRACARBOXYLIC ACID, 1,2-Benzenedicarboxylic acid, 4,4'-carbonylbis-, Benzophenone-3,3',4,4'-tetracarboxylic acid, benzophenone-3,3',4,4'-tetracarbonic acid, 3,3',4,4'-Benzophenonetetracarboxylic acid, 4-(3,4-dicarboxybenzoyl)phthalic acid, BENZOPHENONE TETRACARBOXYLIC ACID, orb1706258, BENZOPHENONETETRACARBOXYLICACID