CAS 43080-50-8 appears in our catalog under these names: 5,5'–Carbonyldiisophthalicacid, 5,5'-Carbonyldiisophthalic acid, 97%, 97%, 5,5'-Carbonyldiisophthalic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
5-(3,5-dicarboxybenzoyl)benzene-1,3-dicarboxylic acid (CAS 43080-50-8) is a chemical compound with the molecular formula C17H10O9 and a molecular weight of 358.3 g/mol. IUPAC name: 5-(3,5-dicarboxybenzoyl)benzene-1,3-dicarboxylic acid. InChIKey: NDEURWFVDGQGAG-UHFFFAOYSA-N.
| Molecular formula | C17H10O9 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 5-(3,5-dicarboxybenzoyl)benzene-1,3-dicarboxylic acid |
| InChIKey | NDEURWFVDGQGAG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C(=O)C2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)