CAS 24815-25-6 is the registry number for Ethybenztropine (hydrobromide). Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,5S)-3-benzhydryloxy-8-ethyl-8-azabicyclo[3.2.1]octane;hydrobromide (CAS 24815-25-6) is a chemical compound with the molecular formula C22H28BrNO and a molecular weight of 402.4 g/mol. IUPAC name: (1R,5S)-3-benzhydryloxy-8-ethyl-8-azabicyclo[3.2.1]octane;hydrobromide. InChIKey: VDVKOVNNSSRFGV-ILOBMFFHSA-N.
| Molecular formula | C22H28BrNO |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | (1R,5S)-3-benzhydryloxy-8-ethyl-8-azabicyclo[3.2.1]octane;hydrobromide |
| InChIKey | VDVKOVNNSSRFGV-ILOBMFFHSA-N |
| SMILES | CCN1[C@@H]2CC[C@H]1CC(C2)OC(C3=CC=CC=C3)C4=CC=CC=C4.Br |
Computed by PubChem (NCBI)