Products 77239-98-6

CAS 77239-98-6 is the registry number for Bromadol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

4-(4-bromophenyl)-4-(dimethylamino)-1-(2-phenylethyl)cyclohexan-1-ol (CAS 77239-98-6) is a chemical compound with the molecular formula C22H28BrNO and a molecular weight of 402.4 g/mol. IUPAC name: 4-(4-bromophenyl)-4-(dimethylamino)-1-(2-phenylethyl)cyclohexan-1-ol. InChIKey: PRSUTWWKYIVBEU-UHFFFAOYSA-N.

Identity
Molecular formulaC22H28BrNO
Molecular weight402.4 g/mol
IUPAC name4-(4-bromophenyl)-4-(dimethylamino)-1-(2-phenylethyl)cyclohexan-1-ol
InChIKeyPRSUTWWKYIVBEU-UHFFFAOYSA-N
SMILESCN(C)C1(CCC(CC1)(CCC2=CC=CC=C2)O)C3=CC=C(C=C3)Br

Computed by PubChem (NCBI)