CAS 2481740-94-5 appears in our catalog under these names: AAZ–A 154, Zalsupindole, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 250mg.
(2R)-1-(5-methoxyindol-1-yl)-N,N-dimethylpropan-2-amine (CAS 2481740-94-5) is a chemical compound with the molecular formula C14H20N2O and a molecular weight of 232.32 g/mol. IUPAC name: (2R)-1-(5-methoxyindol-1-yl)-N,N-dimethylpropan-2-amine. InChIKey: KHEUWLQKCXGVEL-LLVKDONJSA-N.
| Molecular formula | C14H20N2O |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (2R)-1-(5-methoxyindol-1-yl)-N,N-dimethylpropan-2-amine |
| InChIKey | KHEUWLQKCXGVEL-LLVKDONJSA-N |
| SMILES | C[C@H](CN1C=CC2=C1C=CC(=C2)OC)N(C)C |
Computed by PubChem (NCBI)