CAS 24827-78-9 is the registry number for N,N'-Diethyl-N'-(4-nitrophenyl)-N-phenylurea. Offered by: TRC. Available pack sizes: 100mg.
1,3-diethyl-1-(4-nitrophenyl)-3-phenylurea (CAS 24827-78-9) is a chemical compound with the molecular formula C17H19N3O3 and a molecular weight of 313.35 g/mol. IUPAC name: 1,3-diethyl-1-(4-nitrophenyl)-3-phenylurea. InChIKey: MWQXCGJYCCBRJK-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O3 |
|---|---|
| Molecular weight | 313.35 g/mol |
| IUPAC name | 1,3-diethyl-1-(4-nitrophenyl)-3-phenylurea |
| InChIKey | MWQXCGJYCCBRJK-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=CC=C1)C(=O)N(CC)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)