Products 314766-74-0
CAS 314766-74-0 is the registry number for 4-Amino-N'-(1-(2,4-dimethoxyphenyl)ethylidene)benzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]benzamide (CAS 314766-74-0) is a chemical compound with the molecular formula C17H19N3O3 and a molecular weight of 313.35 g/mol. IUPAC name: 4-amino-N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]benzamide. InChIKey: XUWFICKNSARJBR-YBFXNURJSA-N.
| Molecular formula | C17H19N3O3 |
|---|---|
| Molecular weight | 313.35 g/mol |
| IUPAC name | 4-amino-N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]benzamide |
| InChIKey | XUWFICKNSARJBR-YBFXNURJSA-N |
| SMILES | C/C(=N\NC(=O)C1=CC=C(C=C1)N)/C2=C(C=C(C=C2)OC)OC |
Computed by PubChem (NCBI)