CAS 24829-12-7 is the registry number for 2-(((1H-1,2,4-Triazol-3-yl)imino)methyl)phenol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol (CAS 24829-12-7) is a chemical compound with the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. IUPAC name: 2-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol. InChIKey: BKYHBHVZLQLDIP-BJMVGYQFSA-N.
| Molecular formula | C9H8N4O |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | 2-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol |
| InChIKey | BKYHBHVZLQLDIP-BJMVGYQFSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/C2=NC=NN2)O |
Computed by PubChem (NCBI)