CAS 920502-11-0 is the registry number for 4-(1H-1,2,4-Triazol-1-yl)benzaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(NE)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methylidene]hydroxylamine (CAS 920502-11-0) is a chemical compound with the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. IUPAC name: (NE)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methylidene]hydroxylamine. InChIKey: IXQFSTIIAGMVKE-LFYBBSHMSA-N.
| Molecular formula | C9H8N4O |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | (NE)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methylidene]hydroxylamine |
| InChIKey | IXQFSTIIAGMVKE-LFYBBSHMSA-N |
| SMILES | C1=CC(=CC=C1/C=N/O)N2C=NC=N2 |
Computed by PubChem (NCBI)