Products 2483735-36-8
CAS 2483735-36-8 is the registry number for Adipate-13C6 (sodium). Offered by: MedChemExpress. Available pack sizes: 1 mg.
Disodium;(1,2,3,4,5,6-13C6)hexanedioate (CAS 2483735-36-8) is a chemical compound with the molecular formula C6H8Na2O4 and a molecular weight of 196.06 g/mol. IUPAC name: disodium;(1,2,3,4,5,6-13C6)hexanedioate. InChIKey: KYKFCSHPTAVNJD-MABOOHTNSA-L.
| Molecular formula | C6H8Na2O4 |
|---|---|
| Molecular weight | 196.06 g/mol |
| IUPAC name | disodium;(1,2,3,4,5,6-13C6)hexanedioate |
| InChIKey | KYKFCSHPTAVNJD-MABOOHTNSA-L |
| SMILES | [13CH2]([13CH2][13CH2][13C](=O)[O-])[13CH2][13C](=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)