CAS 7486-38-6 appears in our catalog under these names: Sodium adipate, 98%, Disodium Adipate, Disodium Adipate, >98.0%(GC)(T), Disodium Adipate 98%, Disodium Adipate, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100g, 1g, 25g, 5g, 500g, 1000g, 1kg.
Disodium;hexanedioate (CAS 7486-38-6) is a chemical compound with the molecular formula C6H8Na2O4 and a molecular weight of 190.10 g/mol. IUPAC name: disodium;hexanedioate. InChIKey: KYKFCSHPTAVNJD-UHFFFAOYSA-L.
| Molecular formula | C6H8Na2O4 |
|---|---|
| Molecular weight | 190.10 g/mol |
| IUPAC name | disodium;hexanedioate |
| InChIKey | KYKFCSHPTAVNJD-UHFFFAOYSA-L |
| SMILES | C(CCC(=O)[O-])CC(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)