Products 2483736-12-3
CAS 2483736-12-3 is the registry number for 2,4,5-Trichlorophenol-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 500 μg, 1 mg, 5 mg.
3,4,6-trichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 2483736-12-3) is a chemical compound with the molecular formula C6H3Cl3O and a molecular weight of 203.40 g/mol. IUPAC name: 3,4,6-trichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: LHJGJYXLEPZJPM-IDEBNGHGSA-N.
| Molecular formula | C6H3Cl3O |
|---|---|
| Molecular weight | 203.40 g/mol |
| IUPAC name | 3,4,6-trichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | LHJGJYXLEPZJPM-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13C]([13C](=[13CH][13C](=[13C]1Cl)Cl)Cl)O |
Computed by PubChem (NCBI)