Products 93951-81-6
CAS 93951-81-6 appears in our catalog under these names: 2,3,6-Trichlorophenol-4,5-d2, 97 atom % D, min 98% Chemical Purity, 2,3,6-Trichlorophenol-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
2,3,6-trichloro-4,5-dideuteriophenol (CAS 93951-81-6) is a chemical compound with the molecular formula C6H3Cl3O and a molecular weight of 199.5 g/mol. IUPAC name: 2,3,6-trichloro-4,5-dideuteriophenol. InChIKey: XGCHAIDDPMFRLJ-QDNHWIQGSA-N.
| Molecular formula | C6H3Cl3O |
|---|---|
| Molecular weight | 199.5 g/mol |
| IUPAC name | 2,3,6-trichloro-4,5-dideuteriophenol |
| InChIKey | XGCHAIDDPMFRLJ-QDNHWIQGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)O)Cl)Cl)[2H] |
Computed by PubChem (NCBI)