CAS 2483736-24-7 is the registry number for Sodium 2-oxobutanoate-13C4, 99.5%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 25 mg, 100 mg, 5 mg.
CAS 2483736-24-7 identifies a chemical compound with the molecular formula C4H6NaO3 and a molecular weight of 129.049 g/mol. InChIKey: XLTHMCKKCRLNGQ-UJNKEPEOSA-N.
| Molecular formula | C4H6NaO3 |
|---|---|
| Molecular weight | 129.049 g/mol |
| InChIKey | XLTHMCKKCRLNGQ-UJNKEPEOSA-N |
| SMILES | [13CH3][13CH2][13C](=O)[13C](=O)O.[Na] |
Computed by PubChem (NCBI)