CAS 2483824-49-1 is the registry number for Sodium 2-oxobutanoate-13C,d4, 98.0%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg.
CAS 2483824-49-1 identifies a chemical compound with the molecular formula C4H6NaO3 and a molecular weight of 130.10 g/mol. InChIKey: XLTHMCKKCRLNGQ-FSDPBAKOSA-N.
| Molecular formula | C4H6NaO3 |
|---|---|
| Molecular weight | 130.10 g/mol |
| InChIKey | XLTHMCKKCRLNGQ-FSDPBAKOSA-N |
| SMILES | [2H][13CH]([2H])C([2H])([2H])C(=O)C(=O)O.[Na] |
Computed by PubChem (NCBI)