CAS 24838-13-9 appears in our catalog under these names: 2-(2,3,6-Triazino(5,4-β)indol-3-ylthio)acetic acid, 2-(2,3,6-Triazino[5,4-b]indol-3-ylthio)acetic acid, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 2000mg, 1000mg, 5000mg, 1g.
2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetic acid (CAS 24838-13-9) is a chemical compound with the molecular formula C11H8N4O2S and a molecular weight of 260.27 g/mol. IUPAC name: 2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetic acid. InChIKey: FOTWYBLOBBPUIH-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O2S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | 2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetic acid |
| InChIKey | FOTWYBLOBBPUIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)N=C(N=N3)SCC(=O)O |
Computed by PubChem (NCBI)