CAS 304003-84-7 is the registry number for 2-((5-Amino-1,3,4-thiadiazol-2-yl)methyl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]isoindole-1,3-dione (CAS 304003-84-7) is a chemical compound with the molecular formula C11H8N4O2S and a molecular weight of 260.27 g/mol. IUPAC name: 2-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]isoindole-1,3-dione. InChIKey: IOOWPGUJRXQVSC-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O2S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]isoindole-1,3-dione |
| InChIKey | IOOWPGUJRXQVSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=NN=C(S3)N |
Computed by PubChem (NCBI)