Products 2483829-93-0
CAS 2483829-93-0 appears in our catalog under these names: Glycocyamine–15N,13C2, Glycocyamine-15N,13C2, 97.0%, 97.0%, Glycocyamine-15N,13C2, 97.40%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 1 mg, 5 mg, 10 mg.
2-(diaminomethylideneamino)acetic acid (CAS 2483829-93-0) is a chemical compound with the molecular formula C3H7N3O2 and a molecular weight of 120.09 g/mol. IUPAC name: 2-(diaminomethylideneamino)acetic acid. InChIKey: BPMFZUMJYQTVII-LQAOFMTQSA-N.
| Molecular formula | C3H7N3O2 |
|---|---|
| Molecular weight | 120.09 g/mol |
| IUPAC name | 2-(diaminomethylideneamino)acetic acid |
| InChIKey | BPMFZUMJYQTVII-LQAOFMTQSA-N |
| SMILES | [13CH2]([13C](=O)O)[15N]=C(N)N |
Computed by PubChem (NCBI)