CAS 634616-40-3 is the registry number for Guanidinoacetic-13C2 Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
2-(diaminomethylideneamino)acetic acid (CAS 634616-40-3) is a chemical compound with the molecular formula C3H7N3O2 and a molecular weight of 119.09 g/mol. IUPAC name: 2-(diaminomethylideneamino)acetic acid. InChIKey: BPMFZUMJYQTVII-ZDOIIHCHSA-N.
| Molecular formula | C3H7N3O2 |
|---|---|
| Molecular weight | 119.09 g/mol |
| IUPAC name | 2-(diaminomethylideneamino)acetic acid |
| InChIKey | BPMFZUMJYQTVII-ZDOIIHCHSA-N |
| SMILES | [13CH2]([13C](=O)O)N=C(N)N |
Computed by PubChem (NCBI)