Products 634616-40-3

CAS 634616-40-3 is the registry number for Guanidinoacetic-13C2 Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.

Structural formula: {0} (CAS {1})

2-(diaminomethylideneamino)acetic acid (CAS 634616-40-3) is a chemical compound with the molecular formula C3H7N3O2 and a molecular weight of 119.09 g/mol. IUPAC name: 2-(diaminomethylideneamino)acetic acid. InChIKey: BPMFZUMJYQTVII-ZDOIIHCHSA-N.

Identity
Molecular formulaC3H7N3O2
Molecular weight119.09 g/mol
IUPAC name2-(diaminomethylideneamino)acetic acid
InChIKeyBPMFZUMJYQTVII-ZDOIIHCHSA-N
SMILES[13CH2]([13C](=O)O)N=C(N)N

Computed by PubChem (NCBI)