Products 2483831-62-3
CAS 2483831-62-3 appears in our catalog under these names: D-Alanine-d7, 98 atom % D, min 98% Chemical Purity, D–Alanine–d7, D-Alanine-d7, 99%, 99%, D-Alanine-d7, 99.0%. Offered by: CDN, GLPBio, Chemat, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 5mg, 1mg, 5 mg, 1 mg, 10 mg.
Deuterio (2R)-2,3,3,3-tetradeuterio-2-(dideuterioamino)propanoate (CAS 2483831-62-3) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 96.14 g/mol. IUPAC name: deuterio (2R)-2,3,3,3-tetradeuterio-2-(dideuterioamino)propanoate. InChIKey: QNAYBMKLOCPYGJ-VETUMQINSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 96.14 g/mol |
| IUPAC name | deuterio (2R)-2,3,3,3-tetradeuterio-2-(dideuterioamino)propanoate |
| InChIKey | QNAYBMKLOCPYGJ-VETUMQINSA-N |
| SMILES | [2H][C@](C(=O)O[2H])(C([2H])([2H])[2H])N([2H])[2H] |
Computed by PubChem (NCBI)