Products 2484171-11-9
CAS 2484171-11-9 is the registry number for Dulcite-13C. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(2R,3S,4R,5S)-(613C)hexane-1,2,3,4,5,6-hexol (CAS 2484171-11-9) is a chemical compound with the molecular formula C6H14O6 and a molecular weight of 183.16 g/mol. IUPAC name: (2R,3S,4R,5S)-(613C)hexane-1,2,3,4,5,6-hexol. InChIKey: FBPFZTCFMRRESA-FYUKPSRXSA-N.
| Molecular formula | C6H14O6 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | (2R,3S,4R,5S)-(613C)hexane-1,2,3,4,5,6-hexol |
| InChIKey | FBPFZTCFMRRESA-FYUKPSRXSA-N |
| SMILES | C([C@H]([C@@H]([C@@H]([C@H]([13CH2]O)O)O)O)O)O |
Computed by PubChem (NCBI)