Products 2484872-46-8

CAS 2484872-46-8 is the registry number for Aldol&reg, 515 acetate, Biosynth Patent: EP 2427431 and US 8940909. Offered by: Biosynth. Available pack sizes: 2,5g, 1g, 5g, 10g, 25g.

Aldol&reg, 515 acetate, Biosynth Patent: EP 2427431 and US 8940909
Biosynth
  • size: 2,5g, 1g, 5g, 10g
  • Variants: 5
View product
Structural formula: {0} (CAS {1})

[1-[2-[4-(dimethylamino)benzoyl]phenyl]indol-3-yl] acetate (CAS 2484872-46-8) is a chemical compound with the molecular formula C25H22N2O3 and a molecular weight of 398.5 g/mol. IUPAC name: [1-[2-[4-(dimethylamino)benzoyl]phenyl]indol-3-yl] acetate. InChIKey: NWIXDGSFOODYKO-UHFFFAOYSA-N.

Identity
Molecular formulaC25H22N2O3
Molecular weight398.5 g/mol
IUPAC name[1-[2-[4-(dimethylamino)benzoyl]phenyl]indol-3-yl] acetate
InChIKeyNWIXDGSFOODYKO-UHFFFAOYSA-N
SMILESCC(=O)OC1=CN(C2=CC=CC=C21)C3=CC=CC=C3C(=O)C4=CC=C(C=C4)N(C)C

Computed by PubChem (NCBI)

Synonyms: 515 acetate, Biosynth Patent: EP 2427431 and US 8940909, Aldol® 515 acetate, Biosynth Patent: EP 2427431 and US 8940909
Isomers (same molecular formula)
3-(2,3-dimethylphenyl)-2-[(Z)-2-(2-hydroxy-3-methoxyphenyl)ethenyl]quinazolin-4-one C25H22N2O3
2-methyl-N-[4-(5-oxo-3,4-dihydro-2H-1-benzazepine-1-carbonyl)phenyl]benzamide C25H22N2O3
1'-benzyl-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] C25H22N2O3
ethyl (E)-2-cyano-3-[2-methoxy-4-(N-phenylanilino)phenyl]prop-2-enoate C25H22N2O3
N-[(8-hydroxyquinolin-7-yl)-(2-methoxyphenyl)methyl]-2-phenylacetamide C25H22N2O3