Products 58273-90-8
CAS 58273-90-8 is the registry number for 1'-Benzyl-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indoline], 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1'-benzyl-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] (CAS 58273-90-8) is a chemical compound with the molecular formula C25H22N2O3 and a molecular weight of 398.5 g/mol. IUPAC name: 1'-benzyl-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]. InChIKey: SVDIELCXLAOHIR-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O3 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 1'-benzyl-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
| InChIKey | SVDIELCXLAOHIR-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C13C=CC4=C(O3)C=CC(=C4)[N+](=O)[O-])CC5=CC=CC=C5)C |
Computed by PubChem (NCBI)