Products 2484872-68-4
CAS 2484872-68-4 is the registry number for Aldol®, 470 L-alanine amide, acetate salt, Biosynth Patent: EP 2427431 and US 8940909. Offered by: Biosynth. Available pack sizes: 2,5g, 1g, 5g, 10g.
Acetic acid;(2S)-2-amino-N-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]propanamide (CAS 2484872-68-4) is a chemical compound with the molecular formula C28H29N3O6 and a molecular weight of 503.5 g/mol. IUPAC name: acetic acid;(2S)-2-amino-N-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]propanamide. InChIKey: FDCADCXCYWHRBE-NTISSMGPSA-N.
| Molecular formula | C28H29N3O6 |
|---|---|
| Molecular weight | 503.5 g/mol |
| IUPAC name | acetic acid;(2S)-2-amino-N-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]propanamide |
| InChIKey | FDCADCXCYWHRBE-NTISSMGPSA-N |
| SMILES | C[C@@H](C(=O)NC1=CN(C2=CC=CC=C21)C3=CC=CC=C3C(=O)C4=C(C=C(C=C4)OC)OC)N.CC(=O)O |
Computed by PubChem (NCBI)