CAS 75539-79-6 appears in our catalog under these names: Z-D-Phe-Phe-Gly-OH, Z–D–Phe–Phe–Gly–OH, Virus Replication Inhibiting Peptide, Fusion Inhibitory Peptide, 99.83%. Offered by: Creative Peptides, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 1g, 100mg, 250mg, 50mg, 25mg, 500mg, 1000mg.
2-[[(2S)-3-phenyl-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]acetic acid (CAS 75539-79-6) is a chemical compound with the molecular formula C28H29N3O6 and a molecular weight of 503.5 g/mol. IUPAC name: 2-[[(2S)-3-phenyl-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]acetic acid. InChIKey: ZSOSVHOISBSKID-BJKOFHAPSA-N.
| Molecular formula | C28H29N3O6 |
|---|---|
| Molecular weight | 503.5 g/mol |
| IUPAC name | 2-[[(2S)-3-phenyl-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]acetic acid |
| InChIKey | ZSOSVHOISBSKID-BJKOFHAPSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)O)NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)