CAS 2484888-97-1 appears in our catalog under these names: 2,4-Difluoro-1-(1-(4-methoxyphenyl)ethyl)benzene, 2,4-Difluoro-1-(1-(4-methoxyphenyl)ethyl)benzene, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg.
2,4-difluoro-1-[1-(4-methoxyphenyl)ethyl]benzene (CAS 2484888-97-1) is a chemical compound with the molecular formula C15H14F2O and a molecular weight of 248.27 g/mol. IUPAC name: 2,4-difluoro-1-[1-(4-methoxyphenyl)ethyl]benzene. InChIKey: VZVUIJFHFMPJON-UHFFFAOYSA-N.
| Molecular formula | C15H14F2O |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 2,4-difluoro-1-[1-(4-methoxyphenyl)ethyl]benzene |
| InChIKey | VZVUIJFHFMPJON-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)OC)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)