CAS 2484889-24-7 appears in our catalog under these names: 1,4-Difluoro-2-(1-(4-methoxyphenyl)ethyl)benzene, 95%, 1,4-Difluoro-2-(1-(4-methoxyphenyl)ethyl)benzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
1,4-difluoro-2-[1-(4-methoxyphenyl)ethyl]benzene (CAS 2484889-24-7) is a chemical compound with the molecular formula C15H14F2O and a molecular weight of 248.27 g/mol. IUPAC name: 1,4-difluoro-2-[1-(4-methoxyphenyl)ethyl]benzene. InChIKey: KUAUJGYHZCWLKD-UHFFFAOYSA-N.
| Molecular formula | C15H14F2O |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 1,4-difluoro-2-[1-(4-methoxyphenyl)ethyl]benzene |
| InChIKey | KUAUJGYHZCWLKD-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)OC)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)