Products 2484889-26-9

CAS 2484889-26-9 is the registry number for Methyl 2-isopropoxy-4,5-dimethylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4,5-dimethyl-2-propan-2-yloxybenzoate (CAS 2484889-26-9) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: methyl 4,5-dimethyl-2-propan-2-yloxybenzoate. InChIKey: CVXWYXLQJPSXFO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O3
Molecular weight222.28 g/mol
IUPAC namemethyl 4,5-dimethyl-2-propan-2-yloxybenzoate
InChIKeyCVXWYXLQJPSXFO-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C)OC(C)C)C(=O)OC

Computed by PubChem (NCBI)