Products 2485022-37-3
CAS 2485022-37-3 is the registry number for tert-butyl (4R)-4-hydroxy-2,2-dimethyl-piperidine-1-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (4R)-4-hydroxy-2,2-dimethylpiperidine-1-carboxylate (CAS 2485022-37-3) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl (4R)-4-hydroxy-2,2-dimethylpiperidine-1-carboxylate. InChIKey: YDWHJXKEBCZNDT-SECBINFHSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl (4R)-4-hydroxy-2,2-dimethylpiperidine-1-carboxylate |
| InChIKey | YDWHJXKEBCZNDT-SECBINFHSA-N |
| SMILES | CC1(C[C@@H](CCN1C(=O)OC(C)(C)C)O)C |
Computed by PubChem (NCBI)