CAS 248602-44-0 appears in our catalog under these names: Di-fmoc-3,5-diaminobenzoic acid, 95%, Di-Fmoc-diaminobenzoic acid, 95%, 95%, 3,5-Bis((((9H-fluoren-9-yl)methoxy)carbonyl)amino)benzoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
3,5-bis(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 248602-44-0) is a chemical compound with the molecular formula C37H28N2O6 and a molecular weight of 596.6 g/mol. IUPAC name: 3,5-bis(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: VXSIWQPSWBKDFB-UHFFFAOYSA-N.
| Molecular formula | C37H28N2O6 |
|---|---|
| Molecular weight | 596.6 g/mol |
| IUPAC name | 3,5-bis(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | VXSIWQPSWBKDFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC(=CC(=C4)C(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57 |
Computed by PubChem (NCBI)