CAS 345958-22-7 appears in our catalog under these names: Di-fmoc-3,4-diaminobenzoic acid, 95%, 3,4-Bis((((9H-fluoren-9-yl)methoxy)carbonyl)amino)benzoic acid, 96%, 96%, 3,4-Bis((((9H-fluoren-9-yl)methoxy)carbonyl)amino)benzoic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg.
3,4-bis(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 345958-22-7) is a chemical compound with the molecular formula C37H28N2O6 and a molecular weight of 596.6 g/mol. IUPAC name: 3,4-bis(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: SULLCIOIUDBVRI-UHFFFAOYSA-N.
| Molecular formula | C37H28N2O6 |
|---|---|
| Molecular weight | 596.6 g/mol |
| IUPAC name | 3,4-bis(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | SULLCIOIUDBVRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=C(C=C4)C(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57 |
Computed by PubChem (NCBI)