CAS 2487526-28-1 is the registry number for GEM144, 96.62%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 100 mg, 5 mg, 50 mg.
(E)-3-[4-[3-(1-adamantyl)-4-[1-(hydroxyamino)-1-oxopropan-2-yl]oxyphenyl]phenyl]prop-2-enoic acid (CAS 2487526-28-1) is a chemical compound with the molecular formula C28H31NO5 and a molecular weight of 461.5 g/mol. IUPAC name: (E)-3-[4-[3-(1-adamantyl)-4-[1-(hydroxyamino)-1-oxopropan-2-yl]oxyphenyl]phenyl]prop-2-enoic acid. InChIKey: PIJPEZHKJKJZHS-RUDMXATFSA-N.
| Molecular formula | C28H31NO5 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | (E)-3-[4-[3-(1-adamantyl)-4-[1-(hydroxyamino)-1-oxopropan-2-yl]oxyphenyl]phenyl]prop-2-enoic acid |
| InChIKey | PIJPEZHKJKJZHS-RUDMXATFSA-N |
| SMILES | CC(C(=O)NO)OC1=C(C=C(C=C1)C2=CC=C(C=C2)/C=C/C(=O)O)C34CC5CC(C3)CC(C5)C4 |
Computed by PubChem (NCBI)