Products 2487526-28-1

CAS 2487526-28-1 is the registry number for GEM144, 96.62%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 100 mg, 5 mg, 50 mg.

Structural formula: {0} (CAS {1})

(E)-3-[4-[3-(1-adamantyl)-4-[1-(hydroxyamino)-1-oxopropan-2-yl]oxyphenyl]phenyl]prop-2-enoic acid (CAS 2487526-28-1) is a chemical compound with the molecular formula C28H31NO5 and a molecular weight of 461.5 g/mol. IUPAC name: (E)-3-[4-[3-(1-adamantyl)-4-[1-(hydroxyamino)-1-oxopropan-2-yl]oxyphenyl]phenyl]prop-2-enoic acid. InChIKey: PIJPEZHKJKJZHS-RUDMXATFSA-N.

Identity
Molecular formulaC28H31NO5
Molecular weight461.5 g/mol
IUPAC name(E)-3-[4-[3-(1-adamantyl)-4-[1-(hydroxyamino)-1-oxopropan-2-yl]oxyphenyl]phenyl]prop-2-enoic acid
InChIKeyPIJPEZHKJKJZHS-RUDMXATFSA-N
SMILESCC(C(=O)NO)OC1=C(C=C(C=C1)C2=CC=C(C=C2)/C=C/C(=O)O)C34CC5CC(C3)CC(C5)C4

Computed by PubChem (NCBI)

Synonyms: orb1687126