Products 638132-34-0
CAS 638132-34-0 appears in our catalog under these names: ONO–7300243, ONO-7300243, 2-(4-((3,5-Dimethoxy-4-methyl-N-(3-phenylpropyl)benzamido)methyl)phenyl)acetic acid, 95%, 95%, ONO-7300243, 98.11%, ONO-7300243 (Standard). Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, 500mg, 1mg, 10mg, 50mg, 100mg, 10mM/1mL.
2-[4-[[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]acetic acid (CAS 638132-34-0) is a chemical compound with the molecular formula C28H31NO5 and a molecular weight of 461.5 g/mol. IUPAC name: 2-[4-[[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]acetic acid. InChIKey: WGABOZPQOOZAOI-UHFFFAOYSA-N.
| Molecular formula | C28H31NO5 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | 2-[4-[[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]acetic acid |
| InChIKey | WGABOZPQOOZAOI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1OC)C(=O)N(CCCC2=CC=CC=C2)CC3=CC=C(C=C3)CC(=O)O)OC |
Computed by PubChem (NCBI)