Products 2488625-40-5
CAS 2488625-40-5 is the registry number for Methyl 6,8-dichloroimidazo[1,2-a]pyrazine-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6,8-dichloroimidazo[1,2-a]pyrazine-2-carboxylate (CAS 2488625-40-5) is a chemical compound with the molecular formula C8H5Cl2N3O2 and a molecular weight of 246.05 g/mol. IUPAC name: methyl 6,8-dichloroimidazo[1,2-a]pyrazine-2-carboxylate. InChIKey: MTFAHRPXNQYKEQ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O2 |
|---|---|
| Molecular weight | 246.05 g/mol |
| IUPAC name | methyl 6,8-dichloroimidazo[1,2-a]pyrazine-2-carboxylate |
| InChIKey | MTFAHRPXNQYKEQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C=C(N=C(C2=N1)Cl)Cl |
Computed by PubChem (NCBI)