Products 2763976-92-5
CAS 2763976-92-5 appears in our catalog under these names: 2-{2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidin-5-yl}acetic acid, 97%, 97%, 2-(2,4-dichloropyrrolo[3,2-d]pyrimidin-5-yl)acetic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
2-(2,4-dichloropyrrolo[3,2-d]pyrimidin-5-yl)acetic acid (CAS 2763976-92-5) is a chemical compound with the molecular formula C8H5Cl2N3O2 and a molecular weight of 246.05 g/mol. IUPAC name: 2-(2,4-dichloropyrrolo[3,2-d]pyrimidin-5-yl)acetic acid. InChIKey: RXOFKIYAYRJWQV-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O2 |
|---|---|
| Molecular weight | 246.05 g/mol |
| IUPAC name | 2-(2,4-dichloropyrrolo[3,2-d]pyrimidin-5-yl)acetic acid |
| InChIKey | RXOFKIYAYRJWQV-UHFFFAOYSA-N |
| SMILES | C1=CN(C2=C1N=C(N=C2Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)