Products 2489502-78-3

CAS 2489502-78-3 is the registry number for tert-butyl (E)-4,4-difluorobut-2-enoate, 94%, 94%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl (E)-4,4-difluorobut-2-enoate (CAS 2489502-78-3) is a chemical compound with the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. IUPAC name: tert-butyl (E)-4,4-difluorobut-2-enoate. InChIKey: ZGLONWZKYVXQKI-SNAWJCMRSA-N.

Identity
Molecular formulaC8H12F2O2
Molecular weight178.18 g/mol
IUPAC nametert-butyl (E)-4,4-difluorobut-2-enoate
InChIKeyZGLONWZKYVXQKI-SNAWJCMRSA-N
SMILESCC(C)(C)OC(=O)/C=C/C(F)F

Computed by PubChem (NCBI)