Products 24902-23-6
CAS 24902-23-6 appears in our catalog under these names: 10α–hydroxy–δ8–THC, 10α-Hydroxy-Δ8-THC. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, Get quote.
(6aR,10R,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-1,10-diol (CAS 24902-23-6) is a chemical compound with the molecular formula C21H30O3 and a molecular weight of 330.5 g/mol. IUPAC name: (6aR,10R,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-1,10-diol. InChIKey: KQQMZTULVOWZJR-ZTNFWEORSA-N.
| Molecular formula | C21H30O3 |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | (6aR,10R,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-1,10-diol |
| InChIKey | KQQMZTULVOWZJR-ZTNFWEORSA-N |
| SMILES | CCCCCC1=CC(=C2[C@H]3[C@@H](CC=C([C@@H]3O)C)C(OC2=C1)(C)C)O |
Computed by PubChem (NCBI)