Products 2490398-44-0
CAS 2490398-44-0 is the registry number for (5-Phenyl-3-azabicyclo(3.1.1)heptan-1-yl)methanol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(5-phenyl-3-azabicyclo[3.1.1]heptan-1-yl)methanol;hydrochloride (CAS 2490398-44-0) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: (5-phenyl-3-azabicyclo[3.1.1]heptan-1-yl)methanol;hydrochloride. InChIKey: VAPYJIHOMFBFNE-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | (5-phenyl-3-azabicyclo[3.1.1]heptan-1-yl)methanol;hydrochloride |
| InChIKey | VAPYJIHOMFBFNE-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(CNC2)C3=CC=CC=C3)CO.Cl |
Computed by PubChem (NCBI)