Products 2494277-80-2
CAS 2494277-80-2 is the registry number for Antiparasitic agent-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-ethyl-3-hydroxy-3-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethenyl]indol-2-one (CAS 2494277-80-2) is a chemical compound with the molecular formula C20H17N3O3 and a molecular weight of 347.4 g/mol. IUPAC name: 1-ethyl-3-hydroxy-3-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethenyl]indol-2-one. InChIKey: FKBCCMOTQVAZNH-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O3 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 1-ethyl-3-hydroxy-3-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethenyl]indol-2-one |
| InChIKey | FKBCCMOTQVAZNH-UHFFFAOYSA-N |
| SMILES | CCN1C2=CC=CC=C2C(C1=O)(C(=C)C3=NC(=NO3)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)
Synonyms:
Antiparasitic agent-2, orb1688879